What is the structure of triphosphate?
What is the structure of triphosphate?
Triphosphate(1-)
PubChem CID | 23657868 |
---|---|
Structure | Find Similar Structures |
Molecular Formula | H4O10P3- |
Synonyms | triphosphate(1-) tetrahydrogen triphosphate CHEBI:48313 H4P3O10(-) Q27121138 |
Molecular Weight | 256.95 |
What is the structure of Phenylethene?
2-Phenylethene-1,1-diol
PubChem CID | 12322815 |
---|---|
Structure | Find Similar Structures |
Molecular Formula | C8H8O2 |
Synonyms | 2-Phenylethene-1,1-diol styrene diol 144676-19-7 SCHEMBL131223 DTXSID60488880 |
Molecular Weight | 136.15 |
What is the structure of Cycloheptatrienyl?
Cycloheptatriene (CHT) is an organic compound with the formula C7H8. It is a closed ring of seven carbon atoms joined by three double bonds (as the name implies) and four single bonds. This colourless liquid has been of recurring theoretical interest in organic chemistry.
What is the structure of Isohexyl?
Isohexyl
PubChem CID | 53627942 |
---|---|
Structure | Find Similar Structures |
Molecular Formula | C6H10 |
Synonyms | isohexyl 4-methylpentyl 2-methylpent-1-yl 4-methylpent-1-yl 2-Methyl-3-pentenyl More… |
Molecular Weight | 82.14 |
How is ATP made?
ATP is also formed from the process of cellular respiration in the mitochondria of a cell. This can be through aerobic respiration, which requires oxygen, or anaerobic respiration, which does not. Aerobic respiration produces ATP (along with carbon dioxide and water) from glucose and oxygen.
What is the empirical formula of Phenylethene?
What is the empirical formula of Phenylethene?
Chemical Formula | C22H16 |
---|---|
IUPAC Name | 1-(1-phenylethenyl)phenanthrene |
SMILES String | C=C(c1ccccc1)c2cccc3c2ccc4ccccc34 |
InChI | InChI=1S/C22H16/c1-16(17-8-3-2-4-9-17)19-12-7-13-21-20-11-6-5-10-18(20)14-15-22(19)21/h2-15H,1H2 |
InChIKey | FLKJGHYREUBSHV-UHFFFAOYSA-N |
Why Cycloheptatrienyl cation is aromatic?
The cycloheptatrienyl anion has 8 electrons in its pi system. This makes it antiaromatic and highly unstable. The cycloheptatrienyl (tropylium) cation is aromatic because it also has 6 electronics in its pi system.
Is Cycloheptatrienyl radical aromatic?
The cycloheptatrienyl cation is easily formed, and is often called the tropylium ion. It is an aromatic carbocation, and therefore less reactive than normal carbocations. It is, of course, more stable than its open chain analogue.
What is the Iupac name of Isohexyl?
4-Methylpentan-1-ol
Isohexanol
Names | |
---|---|
Preferred IUPAC name 4-Methylpentan-1-ol | |
Other names 4-Methyl-1-pentanol Isohexyl alcohol | |
Identifiers | |
CAS Number | 626-89-1= |
What is the Iupac name of Neohexyl?
And hence the structure is as follows: Note:The IUPAC name of neo hexyl chloride is 1-chloro-2,2-dimethylbutane, as the parent carbon chain is butane since there are four atoms and in the second carbon two methyl groups are attached and the Cl atom attached in the 1st carbon.